Химия фторорганических соединений:
наука, технологии, производство с 1987 года
1-Бром-1Н,1Н,2Н,2Н-перфтороктан
OBDepict F F F F F F F F F F F F Br F
Цена: 250g - 671 евро
500g - 992 евро
В наличии: 50 г
Синонимы:
8-bromo-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane

Номер по каталогу: 1125

CAS: 161583-34-2

MDL номер: MFCD03840352

Чистота: 97%

Молекулярная Формула: C8H4BrF13

Молекулярный вес: 427.0

Физические свойства

Температура кипения, °C: 165

Плотность, г/см³: 1,8

Дополнительная информация

Ирритант

SMILES: BrCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Заказать