Химия фторорганических соединений:
наука, технологии, производство с 1987 года
1-Бром-4Н-октафторбутан
OBDepict F F F F Br F F F F
Цена: 100g - 918 евро
В наличии: 190 г
Синонимы:
1-Бром-1,1,2,2,3,3,4,4-октафторбутан

Номер по каталогу: 0137

CAS: 558-86-1

MDL номер: MFCD00153707

Чистота: 97%

Молекулярная Формула: C4HBrF8

Молекулярный вес: 280.94

Физические свойства

Температура кипения, °C: 66

Показатель преломления, n20
D
:
1,309

Дополнительная информация

Ирритант

SMILES: FC(C(C(C(Br)(F)F)(F)F)(F)F)F

Заказать