Химия фторорганических соединений:
наука, технологии, производство с 1987 года
1-Бромнонафторбутан
OBDepict F F F F Br F F F F F
Цена: 500g - 605 евро
В наличии: 360 г
Синонимы:
Нонафторбутил бромид
Перфторбутил бромид

Номер по каталогу: 0138

CAS: 375-48-4

MDL номер: MFCD00082622

Чистота: 97%

Молекулярная Формула: C4BrF9

Молекулярный вес: 298.93

Физические свойства

Температура кипения, °C: 44-45

Показатель преломления, n20
D
:
1,292

Плотность, г/см³: 1,9

Дополнительная информация

Ирритант

SMILES: FC(C(C(C(Br)(F)F)(F)F)(F)F)(F)F

Заказать