Химия фторорганических соединений:
наука, технологии, производство с 1987 года
1-Бром-1Н,1Н,2Н,2Н-перфтордекан
OBDepict Br F F F F F F F F F F F F F F F F F
Цена: 1kg - 1100 евро
В наличии: 310 г
Синонимы:
1Н,1Н,2Н,2Н-Перфтордецил бромид
1-Бром-2-(гептадекафтороктил)этан
2-Перфтороктилэтил бромид

Номер по каталогу: 0140

CAS: 21652-57-3

MDL номер: MFCD04039296

Чистота: 97%

Молекулярная Формула: C10H4BrF17

Молекулярный вес: 527.02

Физические свойства

Температура плавления, °C: 35-36

Температура кипения, °C: 84/10 mm Hg

Дополнительная информация

Ирритант

SMILES: BrCCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Заказать