Химия фторорганических соединений:
наука, технологии, производство с 1987 года
1-Бромперфторгексан
OBDepict F F F F F F F F F F F F Br F
Цена: 250g - 571 евро
В наличии: 50 г
Синонимы:
Перфторгексил бромид

Номер по каталогу: 0142

CAS: 335-56-8

MDL номер: MFCD00042349

Чистота: 97%

Молекулярная Формула: C6BrF13

Молекулярный вес: 398.95

Физические свойства

Температура кипения, °C: 98-100

Показатель преломления, n20
D
:
1,2995

Температура вспышки, °C: none

Плотность, г/см³: 1,871

Дополнительная информация

Ирритант

SMILES: FC(C(C(C(C(Br)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)F

Заказать