Химия фторорганических соединений:
наука, технологии, производство с 1987 года
1-Бромперфтороктан
OBDepict F F F F F F F F F F F F F F F F Br F
Цена: 100g - 380 евро
250g - 527 евро
В наличии: 290 г
Синонимы:
Перфтороктил бромид

Номер по каталогу: 0145

CAS: 423-55-2

MDL номер: MFCD00042082

Чистота: 99%

Молекулярная Формула: C8BrF17

Молекулярный вес: 498.96

Физические свойства

Температура плавления, °C: 6

Температура кипения, °C: 141-143

Показатель преломления, n20
D
:
1,305-1,31

Плотность, г/см³: 1,93

Дополнительная информация

Ирритант

SMILES: FC(C(C(C(C(C(C(C(Br)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Заказать