Химия фторорганических соединений:
наука, технологии, производство с 1987 года
3-Хлор-4-(1,1,2,3,3,3-гексафторпропокси)анилин
OBDepict Cl NH 2 O F F F F F F
Цена: 100g - 752 евро
В наличии: 160 г

Номер по каталогу: 1691

CAS: 1100832-66-3

MDL номер: MFCD18641846

Чистота: 97%

Молекулярная Формула: C9H6ClF6NO

Молекулярный вес: 293.59

Физические свойства
Дополнительная информация

Ирритант

SMILES: ClC=1C=C(N)C=CC1OC(C(C(F)(F)F)F)(F)F

Заказать