Химия фторорганических соединений:
наука, технологии, производство с 1987 года
5,5,6,6,7,7,7-Гептафторгептан-1-ол
OBDepict F F F F F F F OH
Цена: 100g - 1197 евро
В наличии: 129 г

Номер по каталогу: 0435

CAS: 883543-64-4

MDL номер: MFCD06247732

Чистота: 97%

Молекулярная Формула: C7H9F7O

Молекулярный вес: 242.14

Физические свойства

Температура кипения, °C: 76-77/16 mm Hg

Плотность, г/см³: 1,6

Дополнительная информация

Ирритант

SMILES: OCCCCC(C(C(F)(F)F)(F)F)(F)F

Заказать