Химия фторорганических соединений:
наука, технологии, производство с 1987 года
4-(Гексафтор-2-гидроксиизопропил)анилин
OBDepict NH 2 HO F F F F F F
Цена: 1kg - 1095 евро
В наличии: 12.42 кг
Производительность в месяц: 100 кг
Синонимы:
2-(4-Аминофенил)гексафторпропан-2-ол
4-(1,1,1,3,3,3-Гексафтор-2-гидроксипроп-2-ил)анилин
2-(4-Аминофенил)-1,1,1,3,3,3-гексафтор-2-пропанол

Номер по каталогу: 0044

CAS: 722-92-9

MDL номер: MFCD00039258

Чистота: 85%min

Молекулярная Формула: C9H7F6NO

Молекулярный вес: 259.15

Физические свойства

Температура плавления, °C: 150-152

Дополнительная информация

Ирритант

Вредный

SMILES: OC(C(F)(F)F)(C(F)(F)F)c1ccc(cc1)N

Заказать