Химия фторорганических соединений:
наука, технологии, производство с 1987 года
Гексафтор-2,3-бис(трифторметил)бутан-2,3-диол
OBDepict OH HO F F F F F F F F F F F F
Цена: 1kg - 1159 евро
В наличии: 3.36 кг
Производительность в месяц: 50 кг
Синонимы:
Перфторпинакол
2,3-Бис(трифторметил)-1,1,1,4,4,4-гексафторбутан-2,3-диол

Номер по каталогу: 0774

CAS: 918-21-8

MDL номер: MFCD00427700

Чистота: 95%min

Молекулярная Формула: C6H2F12O2

Молекулярный вес: 334.06

Физические свойства

Температура плавления, °C: 18-20

Температура кипения, °C: 128-129

Показатель преломления, n20
D
:
1,3102

Плотность, г/см³: 1,86

Дополнительная информация

Ирритант

SMILES: OC(C(C(F)(F)F)(C(F)(F)F)O)(C(F)(F)F)C(F)(F)F

Заказать