Химия фторорганических соединений:
наука, технологии, производство с 1987 года
3,3-Бис(трифторметил)-4,4,4-трифторбутан-1-ол
OBDepict F F F F F F F F F HO
Цена: 100g - 4160 евро
В наличии: 190 г
Синонимы:
4,4,4-Трифтор-3,3-бис(трифторметил)бутан-1-ол
3-(Нонафтор-трет-бутил)пропан-1-ол

Номер по каталогу: 0095

CAS: 14115-49-2

MDL номер: MFCD00459229

Чистота: 97%

Молекулярная Формула: C6H5F9O

Молекулярный вес: 264.09

Физические свойства

Температура плавления, °C: 36-37

Температура кипения, °C: 134-135

Дополнительная информация

Ирритант

SMILES: OCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F

Заказать